ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
cyclohexylacetone |
|
Produkt-Name | cyclohexylacetone |
Englischer Name | cyclohexylacetone;Cyclohexylacetone, (Acetonylcyclohexane);Acetonylcyclohexane;Cyclohexyacetone;1-cyclohexylpropan-2-one;1-cyclohexylacetone |
Molekulare Formel | C9H16O |
Molecular Weight | 140.2227 |
InChl | InChI=1/C9H16O/c1-8(10)7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
CAS Registry Number | 103-78-6 |
EINECS | 203-143-9 |
Molecular Structure | |
Dichte | 0.889g/cm3 |
Siedepunkt | 188.1°C at 760 mmHg |
Brechungsindex | 1.441 |
Flammpunkt | 65.3°C |
Dampfdruck | 0.609mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |