ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-19-5 p-Tolyl disulfide |
|
Produkt-Name | p-Tolyl disulfide |
Englischer Name | p-Tolyl disulfide; |
Molekulare Formel | C14H14S2 |
Molecular Weight | 246.391 |
InChl | InChI=1/C14H14S2/c1-11-3-7-13(8-4-11)15-16-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
CAS Registry Number | 103-19-5 |
EINECS | 203-087-5 |
Molecular Structure | |
Dichte | 1.17g/cm3 |
Schmelzpunkt | 43-46℃ |
Siedepunkt | 349.5°C at 760 mmHg |
Brechungsindex | 1.649 |
Flammpunkt | 192.6°C |
Dampfdruck | 9.46E-05mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |