ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-Nitroformanilide |
|
Produkt-Name | 3-Nitroformanilide |
Englischer Name | 3-Nitroformanilide;N-(3-nitrophenyl)formamide |
Molekulare Formel | C7H6N2O3 |
Molecular Weight | 166.1341 |
InChl | InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
CAS Registry Number | 102-38-5 |
Molecular Structure | |
Dichte | 1.407g/cm3 |
Siedepunkt | 368.5°C at 760 mmHg |
Brechungsindex | 1.641 |
Flammpunkt | 176.7°C |
Dampfdruck | 1.27E-05mmHg at 25°C |
Risk Codes | R20/22##Harmful by inhalation and if swallowed.:; |
Safety Beschreibung | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |