ChemIndex - Bezplatná chemická databáze CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Isopulegylacetát, směs izomerů |
|
název výrobku | Isopulegylacetát, směs izomerů |
Synonyma | ;(1R,2R,5R)-5-methyl-2-(1-methylethenyl)cyklohexyl-acetát; (1R,2R,5S)-5-methyl-2-(1-methylethenyl)cyklohexylacetát; (1R,2S,5S)-5-methyl-2-(1-methylethenyl)cyklohexylacetát; |
Anglický název | Isopulegyl acetate, mixture of isomers;(1R,2R,5R)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2R,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2S,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate |
Molekulární vzorec | C12H20O2 |
Molekulová hmotnost | 196.286 |
InChl | InChI=1/C12H20O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h9,11-12H,1,5-7H2,2-4H3/t9-,11-,12+/m0/s1 |
Registrační číslo CAS | 89-49-6 |
Molekulární struktura | |
Hustota | 0.94g/cm3 |
Bod varu | 248°C at 760 mmHg |
Index lomu | 1.458 |
Bod vzplanutí | 85.6°C |
Tlak par | 0.0248mmHg at 25°C |
Bezpečnostní Popis | S24/25##Avoid contact with skin and eyes.:; |
MSDS |