ChemIndex - Bezplatná chemická databáze CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
79-35-6 1,1-dichloro-2,2-difluoroethylene |
|
název výrobku | 1,1-dichloro-2,2-difluoroethylene |
Anglický název | 1,1-dichloro-2,2-difluoroethylene;FC-1112a;1-chloro-1,2,2-trifluoroethene |
Molekulární vzorec | C2Cl2F2 |
Molekulová hmotnost | 132.9242 |
InChl | InChI=1/C2Cl2F2/c3-1(4)2(5)6 |
Registrační číslo CAS | 79-35-6 |
EINECS | 201-198-3 |
Molekulární struktura | |
Hustota | 1.503g/cm3 |
Bod varu | 17.3°C at 760 mmHg |
Index lomu | 1.392 |
Tlak par | 999mmHg at 25°C |
Riziko Codes | R23##Toxic by inhalation.||R36/38##Irritating to eyes and skin.:; |
Bezpečnostní Popis | S23##Do not inhale gas/fumes/vapour/spray.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S9##Keep container in a well-ventilated place.:; |
MSDS |