ChemIndex - Bezplatná chemická databáze CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Bis(2-thienyl) ketone |
|
název výrobku | Bis(2-thienyl) ketone |
Anglický název | Bis(2-thienyl) ketone;Di-2-thienyl ketone;Bis(2-thienyl)ketone~Di-2-thienyl ketone;dithiophen-2-ylmethanone |
Molekulární vzorec | C9H6OS2 |
Molekulová hmotnost | 194.2733 |
InChl | InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
Registrační číslo CAS | 704-38-1 |
Molekulární struktura | |
Hustota | 1.326g/cm3 |
Bod tání | 89-91℃ |
Bod varu | 323°C at 760 mmHg |
Index lomu | 1.64 |
Bod vzplanutí | 149.1°C |
Tlak par | 0.00027mmHg at 25°C |
Bezpečnostní Popis | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |