ChemIndex - Bezplatná chemická databáze CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3,4-Dimethoxythiophenol |
|
název výrobku | 3,4-Dimethoxythiophenol |
Anglický název | 3,4-Dimethoxythiophenol;3,4-Dimethoxybenzenethiol |
Molekulární vzorec | C8H10O2S |
Molekulová hmotnost | 170.22 |
InChl | InChI=1/C8H10O2S/c1-9-7-4-3-6(11)5-8(7)10-2/h3-5,11H,1-2H3 |
Registrační číslo CAS | 700-96-9 |
Molekulární struktura | |
Hustota | 1.19 |
Bod varu | 110℃(1 torr) |
Riziko Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
Bezpečnostní Popis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |