ChemIndex - Bezplatná chemická databáze CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
66424-91-7 5-Methyl-2-nitrobenzyl chloride |
|
název výrobku | 5-Methyl-2-nitrobenzyl chloride |
Anglický název | 5-Methyl-2-nitrobenzyl chloride;alpha-chloro-5-methyl-2-nitrotoluene;2-(chloromethyl)-4-methyl-1-nitrobenzene |
Molekulární vzorec | C8H8ClNO2 |
Molekulová hmotnost | 185.6076 |
InChl | InChI=1/C8H8ClNO2/c1-6-2-3-8(10(11)12)7(4-6)5-9/h2-4H,5H2,1H3 |
Registrační číslo CAS | 66424-91-7 |
EINECS | 266-359-2 |
Molekulární struktura | |
Hustota | 1.277g/cm3 |
Bod tání | 41-43℃ |
Bod varu | 292.3°C at 760 mmHg |
Index lomu | 1.566 |
Bod vzplanutí | 130.6°C |
Tlak par | 0.00324mmHg at 25°C |
Symbolů nebezpečnosti | C##Corrosive:; |
Riziko Codes | R34##Causes burns.:; |
Bezpečnostní Popis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |