ChemIndex - Bezplatná chemická databáze CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
5-Nitro-2-furonitrile |
|
název výrobku | 5-Nitro-2-furonitrile |
Anglický název | 5-Nitro-2-furonitrile;5-Nitro-2-furancarbonitrile;5-nitrofuran-2-carbonitrile |
Molekulární vzorec | C5H2N2O3 |
Molekulová hmotnost | 138.081 |
InChl | InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
Registrační číslo CAS | 59-82-5 |
Molekulární struktura | |
Hustota | 1.46g/cm3 |
Bod varu | 234.7°C at 760 mmHg |
Index lomu | 1.544 |
Bod vzplanutí | 95.7°C |
Tlak par | 0.0522mmHg at 25°C |
Riziko Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Bezpečnostní Popis | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |