ChemIndex - Bezplatná chemická databáze CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57878-93-0 2-chloro-4-methylphenyl isothiocyanate |
|
název výrobku | 2-chloro-4-methylphenyl isothiocyanate |
Anglický název | 2-chloro-4-methylphenyl isothiocyanate;2-Chloro-4-methylphenyl isothiocyanate;2-chloro-1-isothiocyanato-4-methylbenzene |
Molekulární vzorec | C8H6ClNS |
Molekulová hmotnost | 183.6579 |
InChl | InChI=1/C8H6ClNS/c1-6-2-3-8(10-5-11)7(9)4-6/h2-4H,1H3 |
Registrační číslo CAS | 57878-93-0 |
Molekulární struktura | |
Hustota | 1.18g/cm3 |
Bod varu | 286.8°C at 760 mmHg |
Index lomu | 1.583 |
Bod vzplanutí | 127.3°C |
Tlak par | 0.00444mmHg at 25°C |
Symbolů nebezpečnosti | Xn##Harmful:; |
Riziko Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpečnostní Popis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |