ChemIndex - Bezplatná chemická databáze CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
tetraiodoethylene |
|
název výrobku | tetraiodoethylene |
Anglický název | tetraiodoethylene;diiodoform;tetraiodoethene |
Molekulární vzorec | C2I4 |
Molekulová hmotnost | 531.6393 |
InChl | InChI=1/C2I4/c3-1(4)2(5)6 |
Registrační číslo CAS | 513-92-8 |
EINECS | 208-176-2 |
Molekulární struktura | |
Hustota | 4.087g/cm3 |
Bod tání | 191-193℃ |
Bod varu | 288.3°C at 760 mmHg |
Index lomu | 1.952 |
Bod vzplanutí | 139.9°C |
Tlak par | 0.00409mmHg at 25°C |
Riziko Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpečnostní Popis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |