ChemIndex - Bezplatná chemická databáze CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
437-17-2 Triphenylcarbenium hexafluorophosphate |
|
název výrobku | Triphenylcarbenium hexafluorophosphate |
Anglický název | Triphenylcarbenium hexafluorophosphate;Trityl hexafluorophosphate;Tritylium hexafluorophosphate;triphenylmethylium hexafluorophosphate |
Molekulová hmotnost | 243.3219 |
InChl | InChI=1/C19H15.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 |
Registrační číslo CAS | 437-17-2 |
EINECS | 207-112-0 |
Molekulární struktura | |
Bod tání | 150℃ |
Symbolů nebezpečnosti | C##Corrosive:; |
Riziko Codes | R20/21##Harmful by inhalation and in contact with skin.||R34##Causes burns.:; |
Bezpečnostní Popis | S28##After contact with skin, wash immediately with plenty of ...:; |
MSDS |