ChemIndex - Bezplatná chemická databáze CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
388088-83-3 2-brom-1-(3,5-dimethyl-1-benzothiofen-2-yl)-1-ethan |
|
název výrobku | 2-brom-1-(3,5-dimethyl-1-benzothiofen-2-yl)-1-ethan |
Synonyma | 2-brom-1-(3,5-dimethyl-1-benzothiofen-2-yl)ethan; |
Anglický název | 2-bromo-1-(3,5-dimethyl-1-benzothiophen-2-yl)-1-ethanone;2-bromo-1-(3,5-dimethyl-1-benzothiophen-2-yl)ethanone |
Molekulární vzorec | C12H11BrOS |
Molekulová hmotnost | 283.1841 |
InChl | InChI=1/C12H11BrOS/c1-7-3-4-11-9(5-7)8(2)12(15-11)10(14)6-13/h3-5H,6H2,1-2H3 |
Registrační číslo CAS | 388088-83-3 |
Molekulární struktura | ![]() |
Hustota | 1.488g/cm3 |
Bod tání | 125℃ |
Bod varu | 378.5°C at 760 mmHg |
Index lomu | 1.655 |
Bod vzplanutí | 182.7°C |
Tlak par | 6.26E-06mmHg at 25°C |
Symbolů nebezpečnosti | |
Riziko Codes | R34##Causes burns.:; |
Bezpečnostní Popis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |