ChemIndex - Bezplatná chemická databáze CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,4-Diethylbenzene |
|
název výrobku | 1,4-Diethylbenzene |
Anglický název | 1,4-Diethylbenzene;Benzene, 1,4-diethyl-;Benzene, p-diethyl-;HSDB 4083;p-Diethylbenzene;p-Ethylethylbenzene;butan-2-ylbenzene;PDEB |
Molekulární vzorec | C10H14 |
Molekulová hmotnost | 134.2182 |
InChl | InChI=1/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
Registrační číslo CAS | 105-05-5 |
EINECS | 203-265-2 |
Molekulární struktura | |
Hustota | 0.86g/cm3 |
Bod tání | -43℃ |
Bod varu | 173.3°C at 760 mmHg |
Index lomu | 1.489 |
Bod vzplanutí | 46.3°C |
Tlak par | 1.7mmHg at 25°C |
Bezpečnostní Popis | S24/25##Avoid contact with skin and eyes.:; |
MSDS |