ChemIndex - Bezplatná chemická databáze CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
(4-Aminophenylthio)acetic acid |
|
název výrobku | (4-Aminophenylthio)acetic acid |
Anglický název | (4-Aminophenylthio)acetic acid;2-(4-Aminophenylthio)acetic acid;4-Aminothiophenoxyacetic acid;[(4-aminophenyl)sulfanyl]acetic acid;[(4-aminophenyl)sulfanyl]acetate |
Molekulární vzorec | C8H8NO2S |
Molekulová hmotnost | 182.2202 |
InChl | InChI=1/C8H9NO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5,9H2,(H,10,11)/p-1 |
Registrační číslo CAS | 104-18-7 |
EINECS | 203-182-1 |
Molekulární struktura | |
Bod varu | 405.3°C at 760 mmHg |
Bod vzplanutí | 198.9°C |
Tlak par | 2.69E-07mmHg at 25°C |
Riziko Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpečnostní Popis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |