ChemIndex - Bezplatná chemická databáze CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N-Phenylurethane |
|
název výrobku | N-Phenylurethane |
Anglický název | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
Molekulární vzorec | C9H11NO2 |
Molekulová hmotnost | 165.1891 |
InChl | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
Registrační číslo CAS | 101-99-5 |
EINECS | 202-995-9 |
Molekulární struktura | |
Hustota | 1.136g/cm3 |
Bod varu | 238°C at 760 mmHg |
Index lomu | 1.558 |
Bod vzplanutí | 79.2°C |
Tlak par | 0.0434mmHg at 25°C |
Riziko Codes | R40##Possible risks of irreversible effects.:; |
Bezpečnostní Popis | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |