ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97358-54-8 (E)-1-(1-methoxypropoxy)hex-3-ene |
|
| Chemical Name | (E)-1-(1-methoxypropoxy)hex-3-ene |
| Synonyms | 3-Hexene, 1-(1-methoxypropoxy)-, (3E)-;(E)-1-(1-Methoxypropoxy)hex-3-ene;3-Hexene, 1-(1-methoxypropoxy)-, (E)-;(3E)-1-(1-methoxypropoxy)hex-3-ene |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.2646 |
| InChl | InChI=1/C10H20O2/c1-4-6-7-8-9-12-10(5-2)11-3/h6-7,10H,4-5,8-9H2,1-3H3/b7-6+ |
| CAS Registry Number | 97358-54-8 |
| EINECS | 306-628-4 |
| Molecular Structure | ![]() |
| Density | 0.859g/cm3 |
| Boiling Point | 197.5°C at 760 mmHg |
| Refractive Index | 1.431 |
| Flash Point | 44.8°C |
| Vapour Pressur | 0.53mmHg at 25°C |
| MSDS | |