ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94267-74-0 2-acetyl-N-(2-methylphenyl)hydrazinecarbothioamide |
|
| Chemical Name | 2-acetyl-N-(2-methylphenyl)hydrazinecarbothioamide |
| Synonyms | 1-acetyl-4-(2-tolyl)thiosemicarbazide |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.2947 |
| InChl | InChI=1/C10H13N3OS/c1-7-5-3-4-6-9(7)11-10(15)13-12-8(2)14/h3-6H,1-2H3,(H,12,14)(H2,11,13,15) |
| CAS Registry Number | 94267-74-0 |
| Molecular Structure | ![]() |
| Density | 1.255g/cm3 |
| Refractive Index | 1.644 |
| MSDS | |