Chemindex > 83-01-2
EN ▼
Diphenylcarbamyl chloride |
|
| Chemical Name | Diphenylcarbamyl chloride |
| Synonyms | Diphenylcarbamoyl chloride;diphenylcarbamic chloride;N,N-Diphenylcarbamyl chloride |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.6776 |
| InChl | InChI=1/C13H10ClNO/c14-13(16)15(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| CAS Registry Number | 83-01-2 |
| EINECS | 201-450-2 |
| Molecular Structure |  |
| Density | 1.269g/cm3 |
| Melting Point | 81-85℃ |
| Boiling Point | 361.8°C at 760 mmHg |
| Refractive Index | 1.633 |
| Flash Point | 172.6°C |
| Water Solubility | reacts |
| Vapour Pressur | 2.02E-05mmHg at 25°C |
| Hazard Symbols |  C##Corrosive:; |
| Risk Codes | R29||R34:; |
| Safety Description | S26||S28A||S36/37/39||S45:; |
| MSDS | |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
Chemical CAS Database Service is provided by ChemIndex.com 