ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7168-23-2 4-(2,4-dimethoxyphenyl)-5-{3-[(4-nitrophenoxy)methyl]phenyl}-2,4-dihydro-3H-1,2,4-triazole-3-thione |
|
| Chemical Name | 4-(2,4-dimethoxyphenyl)-5-{3-[(4-nitrophenoxy)methyl]phenyl}-2,4-dihydro-3H-1,2,4-triazole-3-thione |
| Molecular Formula | C23H20N4O5S |
| Molecular Weight | 464.4937 |
| InChl | InChI=1/C23H20N4O5S/c1-30-19-10-11-20(21(13-19)31-2)26-22(24-25-23(26)33)16-5-3-4-15(12-16)14-32-18-8-6-17(7-9-18)27(28)29/h3-13H,14H2,1-2H3,(H,25,33) |
| CAS Registry Number | 7168-23-2 |
| Molecular Structure | ![]() |
| Density | 1.36g/cm3 |
| Boiling Point | 635.6°C at 760 mmHg |
| Refractive Index | 1.656 |
| Flash Point | 338.2°C |
| Vapour Pressur | 4.67E-16mmHg at 25°C |
| MSDS | |