ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
64855-91-0 5-oxo-DL-proline, compound with L-arginine (1:1) |
|
Chemical Name | 5-oxo-DL-proline, compound with L-arginine (1:1) |
Synonyms | Pirglutargina;DL-Proline, 5-oxo-, compd. with L-arginine (1:1);N~5~-(diaminomethylidene)-L-ornithine - 5-oxoproline (1:1) |
Molecular Formula | C11H21N5O5 |
Molecular Weight | 303.3149 |
InChl | InChI=1/C6H14N4O2.C5H7NO3/c7-4(5(11)12)2-1-3-10-6(8)9;7-4-2-1-3(6-4)5(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);3H,1-2H2,(H,6,7)(H,8,9)/t4-;/m0./s1 |
CAS Registry Number | 64855-91-0 |
EINECS | 265-253-3 |
Molecular Structure | |
Boiling Point | 409.1°C at 760 mmHg |
Flash Point | 201.2°C |
Vapour Pressur | 7.7E-08mmHg at 25°C |
MSDS |