ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
63868-34-8 17-[2-(4-methylphenyl)ethyl]morphinan-3-ol hydrochloride |
|
| Chemical Name | 17-[2-(4-methylphenyl)ethyl]morphinan-3-ol hydrochloride |
| Molecular Formula | C25H32ClNO |
| Molecular Weight | 397.9807 |
| InChl | InChI=1/C25H31NO.ClH/c1-18-5-7-19(8-6-18)11-14-26-15-13-25-12-3-2-4-22(25)24(26)16-20-9-10-21(27)17-23(20)25;/h5-10,17,22,24,27H,2-4,11-16H2,1H3;1H/t22-,24-,25-;/m0./s1 |
| CAS Registry Number | 63868-34-8 |
| Molecular Structure | ![]() |
| Boiling Point | 527.2°C at 760 mmHg |
| Flash Point | 264.4°C |
| Vapour Pressur | 9.83E-12mmHg at 25°C |
| MSDS | |