ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
63765-66-2 17-[2-(4-methoxyphenyl)ethyl]morphinan-3-ol hydrochloride |
|
| Chemical Name | 17-[2-(4-methoxyphenyl)ethyl]morphinan-3-ol hydrochloride |
| Molecular Formula | C25H32ClNO2 |
| Molecular Weight | 413.9801 |
| InChl | InChI=1/C25H31NO2.ClH/c1-28-21-9-5-18(6-10-21)11-14-26-15-13-25-12-3-2-4-22(25)24(26)16-19-7-8-20(27)17-23(19)25;/h5-10,17,22,24,27H,2-4,11-16H2,1H3;1H/t22-,24-,25-;/m0./s1 |
| CAS Registry Number | 63765-66-2 |
| Molecular Structure | ![]() |
| Boiling Point | 545.7°C at 760 mmHg |
| Flash Point | 283.8°C |
| Vapour Pressur | 1.61E-12mmHg at 25°C |
| MSDS | |