ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
60-11-7 Methyl Yellow |
|
| Chemical Name | Methyl Yellow |
| Synonyms | C.I. 11020;C.I. Solvent Yellow 2;C.I. Solvent Yellow 2 (8CI);4-(Dimethylamino)azobenzene;4-Dimethylaminoazobenzene;N,N-Dimethyl-4-phenylazoaniline;Solvent Yellow 2;Dimethyl yellow;Methylgelb;N,N-dimethyl-4-[(E)-phenyldiazenyl]aniline;N,N-dimethyl-4-(phenyldiazenyl)aniline |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.289 |
| InChl | InChI=1/C14H15N3/c1-17(2)14-10-8-13(9-11-14)16-15-12-6-4-3-5-7-12/h3-11H,1-2H3 |
| CAS Registry Number | 60-11-7 |
| EINECS | 200-455-7 |
| Molecular Structure | ![]() |
| Density | 1.027g/cm3 |
| Melting Point | 111-117℃ |
| Boiling Point | 371.05°C at 760 mmHg |
| Refractive Index | 1.567 |
| Flash Point | 178.205°C |
| Water Solubility | 13.6 mg/L |
| Vapour Pressur | 0mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R25||R40||R68:; |
| Safety Description | S36/37||S45:; |
| MSDS | |