ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59235-72-2 2-hydroxybenzoic acid - N-(3,5-dichlorophenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine (1:1) |
|
| Chemical Name | 2-hydroxybenzoic acid - N-(3,5-dichlorophenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine (1:1) |
| Molecular Formula | C25H27Cl2N3O4 |
| Molecular Weight | 504.4056 |
| InChl | InChI=1/C18H21Cl2N3O.C7H6O3/c19-15-12-16(20)14-18(13-15)23(17-2-4-21-5-3-17)7-1-6-22-8-10-24-11-9-22;8-6-4-2-1-3-5(6)7(9)10/h2-5,12-14H,1,6-11H2;1-4,8H,(H,9,10) |
| CAS Registry Number | 59235-72-2 |
| Molecular Structure | ![]() |
| Boiling Point | 520.5°C at 760 mmHg |
| Flash Point | 268.6°C |
| Vapour Pressur | 6.19E-11mmHg at 25°C |
| MSDS | |