ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57989-42-1 2-chloro-1-methyl-1H-indole-3-carbaldehyde thiosemicarbazone |
|
| Chemical Name | 2-chloro-1-methyl-1H-indole-3-carbaldehyde thiosemicarbazone |
| Molecular Formula | C11H11ClN4S |
| Molecular Weight | 266.7498 |
| InChl | InChI=1/C11H11ClN4S/c1-16-9-5-3-2-4-7(9)8(10(16)12)6-14-15-11(13)17/h2-6H,1H3,(H3,13,15,17) |
| CAS Registry Number | 57989-42-1 |
| Molecular Structure | ![]() |
| Density | 1.42g/cm3 |
| Boiling Point | 465.7°C at 760 mmHg |
| Refractive Index | 1.695 |
| Flash Point | 235.4°C |
| Vapour Pressur | 7.54E-09mmHg at 25°C |
| MSDS | |