ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56146-05-5 2-hydroxy-N-[1-methyl-2-oxo-2-(phenylamino)ethyl]benzamide |
|
| Chemical Name | 2-hydroxy-N-[1-methyl-2-oxo-2-(phenylamino)ethyl]benzamide |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.3098 |
| InChl | InChI=1/C16H16N2O3/c1-11(15(20)18-12-7-3-2-4-8-12)17-16(21)13-9-5-6-10-14(13)19/h2-11,19H,1H3,(H,17,21)(H,18,20) |
| CAS Registry Number | 56146-05-5 |
| Molecular Structure | ![]() |
| Density | 1.277g/cm3 |
| Boiling Point | 578.2°C at 760 mmHg |
| Refractive Index | 1.64 |
| Flash Point | 303.5°C |
| Vapour Pressur | 5.72E-14mmHg at 25°C |
| MSDS | |