ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52498-24-5 N-{4-[(1E)-1-ethyl-2-(4-hydroxyphenyl)but-1-en-1-yl]phenyl}-N-hydroxyacetamide |
|
| Chemical Name | N-{4-[(1E)-1-ethyl-2-(4-hydroxyphenyl)but-1-en-1-yl]phenyl}-N-hydroxyacetamide |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.4015 |
| InChl | InChI=1/C20H23NO3/c1-4-19(20(5-2)16-8-12-18(23)13-9-16)15-6-10-17(11-7-15)21(24)14(3)22/h6-13,23-24H,4-5H2,1-3H3/b20-19+ |
| CAS Registry Number | 52498-24-5 |
| Molecular Structure | ![]() |
| Density | 1.177g/cm3 |
| Boiling Point | 497°C at 760 mmHg |
| Refractive Index | 1.62 |
| Flash Point | 254.4°C |
| Vapour Pressur | 1.08E-10mmHg at 25°C |
| MSDS | |