509-60-4 7,8-dihydromorphine |
|
| Product Name | 7,8-dihydromorphine |
| Synonyms | 4,5-Epoxy-17-methylmorphinan-3,6-diol; Dihydromorphine; Paramorphan;(5alpha,6alpha)-17-methyl-4,5-epoxymorphinan-3,6-diol |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.3535 |
| InChl | InChI=1/C17H21NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2,4,10-11,13,16,19-20H,3,5-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1 |
| CAS Registry Number | 509-60-4 |
| EINECS | 208-100-8 |
| Molecular Structure |  |
| Density | 1.4g/cm3 |
| Boiling Point | 475.4°C at 760 mmHg |
| Refractive Index | 1.69 |
| Flash Point | 241.3°C |
| Vapour Pressur | 7.65E-10mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
