ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
41397-50-6 tris(2-hydroxyethyl)ammonium hydrogen maleate |
|
| Chemical Name | tris(2-hydroxyethyl)ammonium hydrogen maleate |
| Synonyms | Tris(2-hydroxyethyl)ammonium hydrogen maleate;Ethanol, 2,2',2''-nitrilotris-, (Z)-2-butenedioate (salt);2,2',2''-nitrilotriethanol (2Z)-but-2-enedioate (salt) |
| Molecular Formula | C10H19NO7 |
| Molecular Weight | 265.2604 |
| InChl | InChI=1/C6H15NO3.C4H4O4/c8-4-1-7(2-5-9)3-6-10;5-3(6)1-2-4(7)8/h8-10H,1-6H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| CAS Registry Number | 41397-50-6 |
| EINECS | 255-351-4 |
| Molecular Structure | ![]() |
| Boiling Point | 335.4°C at 760 mmHg |
| Flash Point | 185°C |
| Vapour Pressur | 8.38E-06mmHg at 25°C |
| MSDS | |