ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
38939-88-7 3-Chloro-4-nitrotoluene |
|
| Chemical Name | 3-Chloro-4-nitrotoluene |
| Synonyms | 2-chloro-4-methyl-1-nitrobenzene |
| Molecular Formula | C7H6ClNO2 |
| Molecular Weight | 171.581 |
| InChl | InChI=1/C7H6ClNO2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 |
| CAS Registry Number | 38939-88-7 |
| EINECS | 254-199-6 |
| Molecular Structure | ![]() |
| Density | 1.324g/cm3 |
| Melting Point | 22-27℃ |
| Boiling Point | 273.4°C at 760 mmHg |
| Refractive Index | 1.57 |
| Flash Point | 119.1°C |
| Vapour Pressur | 0.00962mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |