ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 3389-57-9 4-tetrahydro-1H-pyrrol-1-ylpent-3-en-2-one | |
| Chemical Name | 4-tetrahydro-1H-pyrrol-1-ylpent-3-en-2-one | 
| Synonyms | 4-(pyrrolidin-1-yl)pent-3-en-2-one;(3E)-4-pyrrolidin-1-ylpent-3-en-2-one;(3Z)-4-pyrrolidin-1-ylpent-3-en-2-one | 
| Molecular Formula | C9H15NO | 
| Molecular Weight | 153.2215 | 
| InChl | InChI=1/C9H15NO/c1-8(7-9(2)11)10-5-3-4-6-10/h7H,3-6H2,1-2H3/b8-7- | 
| CAS Registry Number | 3389-57-9 | 
| Molecular Structure |  | 
| Density | 0.995g/cm3 | 
| Melting Point | 114℃ | 
| Boiling Point | 248.4°C at 760 mmHg | 
| Refractive Index | 1.496 | 
| Flash Point | 88.2°C | 
| Vapour Pressur | 0.0243mmHg at 25°C | 
| Hazard Symbols | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; | 
| MSDS | |