ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
32025-65-3 3-Methoxyphenylglyoxal hydrate |
|
| Chemical Name | 3-Methoxyphenylglyoxal hydrate |
| Synonyms | 3-Methoxyphenylglyoxal;AI3-25049;meta-Methoxyphenylglyoxal;Benzeneacetaldehyde, 3-methoxy-alpha-oxo-, hemihydrate;(3-methoxyphenyl)(oxo)acetaldehyde |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.158 |
| InChl | InChI=1/C9H8O3/c1-12-8-4-2-3-7(5-8)9(11)6-10/h2-6H,1H3 |
| CAS Registry Number | 32025-65-3 |
| Molecular Structure | ![]() |
| Density | 1.153g/cm3 |
| Boiling Point | 264.3°C at 760 mmHg |
| Refractive Index | 1.518 |
| Flash Point | 113.5°C |
| Vapour Pressur | 0.00981mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |