ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
30034-13-0 LK-Penicillin In Penicillin G The Derivatives |
|
| Chemical Name | LK-Penicillin In Penicillin G The Derivatives |
| Synonyms | 4-Methoxybenzyl 3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4-oxide;4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-, (4-methoxyphenyl)methyl ester, 4-oxide;GEO: Penicillin-G-p-Methoxybenzyl ester Sulfoxide ;(4-methoxyphenyl)methyl 3,3-dimethyl-4,7-dioxo-6-[(2-phenylacetyl)amino]-4$l4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.538 |
| InChl | InChI=1/C24H26N2O6S/c1-24(2)20(23(29)32-14-16-9-11-17(31-3)12-10-16)26-21(28)19(22(26)33(24)30)25-18(27)13-15-7-5-4-6-8-15/h4-12,19-20,22H,13-14H2,1-3H3,(H,25,27) |
| CAS Registry Number | 30034-13-0 |
| Molecular Structure | ![]() |
| Density | 1.39g/cm3 |
| Boiling Point | 765.5°C at 760 mmHg |
| Refractive Index | 1.652 |
| Flash Point | 416.8°C |
| Vapour Pressur | 2.42E-23mmHg at 25°C |
| MSDS | |