ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
239-35-0 1,2-benzodiphenylene sulfide |
|
| Chemical Name | 1,2-benzodiphenylene sulfide |
| Synonyms | 11-thiabenzo(a)fluorene;1,2-benzo-9-thiafluorene;naphtho(1,2:2,3)thionaphthen;benzo[b]naphtho[2,1-d]thiophene |
| Molecular Formula | C16H10S |
| Molecular Weight | 234.3156 |
| InChl | InChI=1/C16H10S/c1-2-6-12-11(5-1)9-10-14-13-7-3-4-8-15(13)17-16(12)14/h1-10H |
| CAS Registry Number | 239-35-0 |
| EINECS | 205-948-0 |
| Molecular Structure | ![]() |
| Density | 1.292g/cm3 |
| Melting Point | 188-190℃ |
| Boiling Point | 434.3°C at 760 mmHg |
| Refractive Index | 1.809 |
| Flash Point | 163°C |
| Vapour Pressur | 2.44E-07mmHg at 25°C |
| Safety Description | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |