ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
204-14-8 naphtho[1,8-de][1,3]dithiine |
|
| Chemical Name | naphtho[1,8-de][1,3]dithiine |
| Synonyms | Naphtho(1,8-de)-1,3-dithiin;Naphtho[1,8-de]-1,3-dithiin |
| Molecular Formula | C11H8S2 |
| Molecular Weight | 204.3112 |
| InChl | InChI=1/C11H8S2/c1-3-8-4-2-6-10-11(8)9(5-1)12-7-13-10/h1-6H,7H2 |
| CAS Registry Number | 204-14-8 |
| Molecular Structure | ![]() |
| Density | 1.347g/cm3 |
| Boiling Point | 394.8°C at 760 mmHg |
| Refractive Index | 1.776 |
| Flash Point | 212.2°C |
| Vapour Pressur | 4.37E-06mmHg at 25°C |
| MSDS | |