ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
18430-91-6 1-(2-hydroxyphenyl)pentan-1-one |
|
| Chemical Name | 1-(2-hydroxyphenyl)pentan-1-one |
| Synonyms | 1-(2-Hydroxyphenyl)pentan-1-one;1-pentanone, 1-(2-hydroxyphenyl)- |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.2277 |
| InChl | InChI=1/C11H14O2/c1-2-3-7-10(12)9-6-4-5-8-11(9)13/h4-6,8,13H,2-3,7H2,1H3 |
| CAS Registry Number | 18430-91-6 |
| Molecular Structure | ![]() |
| Density | 1.055g/cm3 |
| Boiling Point | 271°C at 760 mmHg |
| Refractive Index | 1.528 |
| Flash Point | 113°C |
| Vapour Pressur | 0.00399mmHg at 25°C |
| MSDS | |