ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
17430-82-9 oleic acid, compound with dodecylamine (1:1) |
|
Chemical Name | oleic acid, compound with dodecylamine (1:1) |
Synonyms | Oleic acid, compound with dodecylamine (1:1);dodecan-1-amine; (Z)-octadec-9-enoic acid |
Molecular Formula | C30H61NO2 |
Molecular Weight | 467.8108 |
InChl | InChI=1/C18H34O2.C12H27N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-13H2,1H3/b10-9-; |
CAS Registry Number | 17430-82-9 |
EINECS | 241-456-2 |
Molecular Structure | ![]() |
Boiling Point | 555.6°C at 760 mmHg |
Flash Point | 289.8°C |
Vapour Pressur | 8.35E-14mmHg at 25°C |
MSDS |