175278-32-7 2-этилтерефталонитрил |
Название продукта |
2-этилтерефталонитрил |
Синонимы |
2-этилбензол-1,4-дикарбонитрил; |
Английское название |
2-ethylterephthalonitrile;2-ethylbenzene-1,4-dicarbonitrile |
Молекулярная формула |
C10H8N2 |
Молекулярный вес |
156.1839 |
InChI |
InChI=1/C10H8N2/c1-2-9-5-8(6-11)3-4-10(9)7-12/h3-5H,2H2,1H3 |
Регистрационный номер CAS |
175278-32-7 |
Молекулярная структура |
|
Плотность |
1.09g/cm3 |
Температура плавления |
98℃ |
Точка кипения |
294.8°C at 760 mmHg |
Показатель преломления |
1.545 |
Температура вспышки |
136.6°C |
Давление пара |
0.00159mmHg at 25°C |
Символы опасности |
Xn##Harmful:;
|
Риск коды |
R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:;
|
Характеристики безопасности |
S36/37##Wear suitable protective clothing and gloves.:;
|
MSDS |
Material Safety Data Sheet |