ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2394-20-9 VMA |
|
produktnavn | VMA |
Engelsk navn | VMA;4-Hydroxy-3-methoxymandelic acid;DL-3-Methoxy-4-hydroxymandelic acid DL-4-Hydroxy-3-methoxy mandelic acid;hydroxy(4-hydroxy-3-methoxyphenyl)acetic acid;Vanillylmandelic acid |
Molekylær Formel | C9H10O5 |
Molekylvekt | 198.1727 |
InChI | InChI=1/C9H10O5/c1-14-7-4-5(2-3-6(7)10)8(11)9(12)13/h2-4,8,10-11H,1H3,(H,12,13) |
CAS-nummer | 2394-20-9;55-10-7 |
EINECS | 200-224-0 |
Molecular Structure | ![]() |
Tetthet | 1.44g/cm3 |
Smeltepunkt | 131-134℃ |
Kokepunkt | 421.3°C at 760 mmHg |
Brytningsindeks | 1.606 |
Flammepunktet | 173.7°C |
Damptrykk | 7.5E-08mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |