4653-08-1 3-(2-thenoyl)propionic acid |
|
produktnavn | 3-(2-thenoyl)propionic acid |
Engelsk navn | 3-(2-thenoyl)propionic acid;4-Oxo-4-(2-thienyl)butyric acid;4-oxo-4-(thiophen-2-yl)butanoic acid;4-oxo-4-thiophen-2-ylbutanoate |
Molekylær Formel | C8H7O3S |
Molekylvekt | 183.2049 |
InChI | InChI=1/C8H8O3S/c9-6(3-4-8(10)11)7-2-1-5-12-7/h1-2,5H,3-4H2,(H,10,11)/p-1 |
CAS-nummer | 4653-08-1 |
EINECS | 225-089-5 |
Molecular Structure | |
Kokepunkt | 400.5°C at 760 mmHg |
Flammepunktet | 196°C |
Damptrykk | 3.93E-07mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall