ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27599-63-9 fluoresceinamine, mixture of isomers |
|
Naam product | fluoresceinamine, mixture of isomers |
Engelse naam | fluoresceinamine, mixture of isomers;Fluoresceinamine, mixture of isomers, (Aminofluorescein);5(6)-Aminofluorescein;FLUORESCEINAMINE, ISOMER 1;4-AMINOFLUORESCEIN;5-amino-3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one;ammonium 6'-hydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-3'-olate |
MF | C20H15NO5 |
Molecuulgewicht | 349.3368 |
InChI | InChI=1/C20H12O5.H3N/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;/h1-10,21-22H;1H3 |
CAS-nummer | 27599-63-9 |
EINECS | 222-043-6 |
Moleculaire Structuur | |
Kookpunt | 620.8°C at 760 mmHg |
Vlampunt | 232.6°C |
Dampdruk | 5.24E-16mmHg at 25°C |
Gevaarsymbolen | Xn:; |
Risico-codes | 22-36/37/38:; |
Veiligheid Omschrijving | 26:; |
MSDS |