ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
493-01-6 cis-Decahydronaphthalene |
|
상품명칭 | cis-Decahydronaphthalene |
영문 이름 | cis-Decahydronaphthalene;cis-bicyclo(4.4.0)decane;cis-decaline;Decahydronaphthalene;Deca hydro naphthalene;Decalin |
분자식 | C10H18 |
분자량 | 138.2499 |
InChI | InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ |
cas번호 | 493-01-6;91-17-8 |
EC번호 | 202-046-9 |
분자 구조 | ![]() |
밀도 | 0.873g/cm3 |
녹는 점 | -31℃ |
비등점 | 190.879°C at 760 mmHg |
굴절 지수 | 1.47 |
인화점 | 57.222°C |
물 용해도 | 6 mg/L at 20℃ |
증기압 | 0.735mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R20##Harmful by inhalation.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |