ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
493-01-6 cis-Decahydronaphthalene |
|
उत्पाद का नाम | cis-Decahydronaphthalene |
अंग्रेज | cis-Decahydronaphthalene;cis-bicyclo(4.4.0)decane;cis-decaline;Decahydronaphthalene;Deca hydro naphthalene;Decalin |
आणविक फार्मूला | C10H18 |
आण्विक वजन | 138.2499 |
InChI | InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ |
कैस रजिस्टी संख्या | 493-01-6;91-17-8 |
EINECS | 202-046-9 |
आणविक संरचना | ![]() |
घनत्व | 0.873g/cm3 |
गलनांक | -31℃ |
उबलने का समय | 190.879°C at 760 mmHg |
अपवर्तक सूचकांक | 1.47 |
फ्लैश प्वाइंट | 57.222°C |
पानी की विलेयता | 6 mg/L at 20℃ |
वाष्प का दबाव | 0.735mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R20##Harmful by inhalation.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |