ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
526-78-3 2,3-Dibromosuccinic acid |
|
उत्पाद का नाम | 2,3-Dibromosuccinic acid |
अंग्रेज | 2,3-Dibromosuccinic acid;Dibromosuccinicacid;2,3-Dibromosucinic Acid;2,3-Dibromo Dibutyric Acid;meso-2,3-Dibromosuccinic acid;(2R,3S)-2,3-dibromobutanedioic acid;(2R,3S)-2,3-dibromobutanedioate |
आणविक फार्मूला | C4H2Br2O4 |
आण्विक वजन | 273.8654 |
InChI | InChI=1/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/p-2/t1-,2+ |
कैस रजिस्टी संख्या | 526-78-3;608-35-5;608-36-6 |
EINECS | 208-396-9 |
आणविक संरचना | |
गलनांक | 255-260℃ |
उबलने का समय | 262.4°C at 760 mmHg |
फ्लैश प्वाइंट | 112.5°C |
पानी की विलेयता | 20 g/L (17℃) |
वाष्प का दबाव | 0.00323mmHg at 25°C |
खतरा प्रतीक | Xi##Irritant:; |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |