528-76-7 2,4-डाइनिट्रोबेंजेनसल्फेनिल क्लोराइड |
उत्पाद का नाम |
2,4-डाइनिट्रोबेंजेनसल्फेनिल क्लोराइड |
समानार्थी |
; 2,4-डिनिट्रोफेनिलसल्फेनिल क्लोराइड; 2,4-डिनिट्रोबेंजेनसल्फेनिल क्लोराइड; 1- (क्लोरोसल्फनील) -2,4-डाइनिट्रोबेंजीन; |
अंग्रेज |
2,4-dinitrobenzenesulfenyl chloride;2,4-Dinitrophenylsulfenyl chloride;2,4-Dinitrobenzenesulphenyl chloride;1-(chlorosulfanyl)-2,4-dinitrobenzene |
आणविक फार्मूला |
C6H3ClN2O4S |
आण्विक वजन |
234.617 |
InChI |
InChI=1/C6H3ClN2O4S/c7-14-6-2-1-4(8(10)11)3-5(6)9(12)13/h1-3H |
कैस रजिस्टी संख्या |
528-76-7 |
EINECS |
208-441-2 |
आणविक संरचना |
|
घनत्व |
1.68g/cm3 |
गलनांक |
94-97℃ |
उबलने का समय |
430.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.662 |
फ्लैश प्वाइंट |
213.9°C |
वाष्प का दबाव |
3.34E-07mmHg at 25°C |
खतरे के कोड |
R34##Causes burns.||R37##Irritating to respiratory system.:;
|
सुरक्षा विवरण |
S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:;
|
MSDS |
Material Safety Data Sheet |