ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
493-01-6 cis-Decahydronaphthalene |
|
Nama produk | cis-Decahydronaphthalene |
Nama bahasa Inggris | cis-Decahydronaphthalene;cis-bicyclo(4.4.0)decane;cis-decaline;Decahydronaphthalene;Deca hydro naphthalene;Decalin |
MF | C10H18 |
Berat Molekul | 138.2499 |
InChI | InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ |
CAS NO | 493-01-6;91-17-8 |
EINECS | 202-046-9 |
Struktur Molekul | |
Kepadatan | 0.873g/cm3 |
Titik lebur | -31℃ |
Titik didih | 190.879°C at 760 mmHg |
Indeks bias | 1.47 |
Titik nyala | 57.222°C |
Kelarutan air | 6 mg/L at 20℃ |
Tekanan uap | 0.735mmHg at 25°C |
Simbol bahaya | Xi##Irritant:; |
Kode Risiko | R20##Harmful by inhalation.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |