ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97-95-0 2-Ethyl-1-butanol |
|
Chemical Name | 2-Ethyl-1-butanol |
Synonyms | 2-Ethylbutyl alcohol;2-ethylbutan-1-ol |
Molecular Formula | C6H14O |
Molecular Weight | 102.1748 |
InChl | InChI=1/C6H14O/c1-3-6(4-2)5-7/h6-7H,3-5H2,1-2H3 |
CAS Registry Number | 97-95-0 |
EINECS | 202-621-4 |
Molecular Structure | ![]() |
Density | 0.814g/cm3 |
Melting Point | -15℃ |
Boiling Point | 146.5°C at 760 mmHg |
Refractive Index | 1.413 |
Flash Point | 58.3°C |
Vapour Pressur | 1.81mmHg at 25°C |
Hazard Symbols | |
Risk Codes | R21/22##Harmful in contact with skin and if swallowed.:; |
MSDS |