2722-36-3 3-Phenyl-1-butanol |
Produkt-Name |
3-Phenyl-1-butanol |
Englischer Name |
3-Phenyl-1-butanol;3-Phenylbutan-1-ol;AI3-11558;Benzenepropanol, gamma-methyl-;(3S)-3-phenylbutan-1-ol;(3R)-3-phenylbutan-1-ol |
Molekulare Formel |
C10H14O |
Molecular Weight |
150.2176 |
InChl |
InChI=1/C10H14O/c1-9(7-8-11)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-/m1/s1 |
CAS Registry Number |
2722-36-3 |
EINECS |
220-335-8 |
Molecular Structure |
|
Dichte |
0.978g/cm3 |
Siedepunkt |
239.7°C at 760 mmHg |
Brechungsindex |
1.519 |
Flammpunkt |
102.1°C |
Dampfdruck |
0.0215mmHg at 25°C |
Safety Beschreibung |
S24/25##Avoid contact with skin and eyes.:;
|
MSDS |
Material Safety Data Sheet |