2216-87-7 3-Undecanone |
Produkt-Name |
3-Undecanone |
Englischer Name |
3-Undecanone;Ethyl n-octyl ketone;undecan-3-one |
Molekulare Formel |
C11H22O |
Molecular Weight |
170.2918 |
InChl |
InChI=1/C11H22O/c1-3-5-6-7-8-9-10-11(12)4-2/h3-10H2,1-2H3 |
CAS Registry Number |
2216-87-7 |
EINECS |
218-700-1 |
Molecular Structure |
|
Dichte |
0.821g/cm3 |
Siedepunkt |
226.9°C at 760 mmHg |
Brechungsindex |
1.425 |
Flammpunkt |
73.2°C |
Dampfdruck |
0.0797mmHg at 25°C |
Safety Beschreibung |
S24/25##Avoid contact with skin and eyes.:;
|
MSDS |
Material Safety Data Sheet |